Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Turimycin is a macrolide antibiotic that is effective against a wide spectrum of pathogens. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17268 |
|---|---|
| Formula | C35H59NO13 |
| Molecular Weight | 701.85 |
| CAS Number | 1392-21-8 |
| SMILES | O=CC[C@@H]1[C@H](O[C@@H]2O[C@H](C)[C@@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@](C)(O)C3)[C@H](N(C)C)[C@H]2O)[C@@H](OC)[C@H](O)CC(O[C@H](C)C/C=C/C=C/[C@H](O)[C@H](C)C1)=O |
| Synonyms | Turimycin; Kitasamycin; Leucomycin V; Selectomycin; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (115.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 91 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.25 mL | 71.24 mL | 142.48 mL |
| 0.5 mM | 2.85 mL | 14.25 mL | 28.5 mL |
| 1 mM | 1.42 mL | 7.12 mL | 14.25 mL |
| 5 mM | 0.28 mL | 1.42 mL | 2.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
