Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Landiolol hydrochloride (ONO1101 hydrochloride) is a highly beta1 selective ultra-short acting beta-blocker (β1/β2 selectivity?=?255:1, a half-life of 4?min)?? acts as an adrenoceptor antagonist. |
|---|
| Catalog Num | A17675 |
|---|---|
| Formula | C25H40ClN3O8 |
| Molecular Weight | 546.05 |
| CAS Number | 144481-98-1 |
| SMILES | O=C(OC[C@H]1OC(C)(C)OC1)CCC2=CC=C(OC[C@@H](O)CNCCNC(N3CCOCC3)=O)C=C2.[H]Cl |
| Synonyms | ONO1101 hydrochloride, ONO 1101, ONO-1101 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (162.99 mM) | |
| Water | 89 mg/mL (162.99 mM) | ||
| Ethanol | 37 mg/mL (67.75 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.31 mL | 91.57 mL | 183.13 mL |
| 0.5 mM | 3.66 mL | 18.31 mL | 36.63 mL |
| 1 mM | 1.83 mL | 9.16 mL | 18.31 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
