Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Penicillin G procaine is a semisynthetic antibiotic prepared by combining penicillin G with Procaine. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17668 |
|---|---|
| Formula | C29H40N4O7S |
| Molecular Weight | 588.72 |
| CAS Number | 6130-64-9 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(cc1)N.CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)Cc3ccccc3)C(=O)O)C.O |
| Synonyms | Abbocillin, Abbocillin DC, Afsillin, Ampin-penicillin, Aquacillin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (151.18 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.99 mL | 84.93 mL | 169.86 mL |
| 0.5 mM | 3.4 mL | 16.99 mL | 33.97 mL |
| 1 mM | 1.7 mL | 8.49 mL | 16.99 mL |
| 5 mM | 0.34 mL | 1.7 mL | 3.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
