Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Procaine hydrochloride is a local anesthetic of the ester type that has a slow onset and a short duration of action. It is mainly used for infiltration anesthesia, peripheral nerve block, and spinal block. |
|---|
| Catalog Num | A17344 |
|---|---|
| Formula | C13H21ClN2O2 |
| Molecular Weight | 272.77 |
| CAS Number | CAS: 51-05-8 |
| SMILES | O=C(OCCN(CC)CC)C1=CC=C(N)C=C1.[H]Cl |
| Synonyms | Procaine hydrochloride; Novocain; Novocaine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (186.97 mM) | |
| Water | 51 mg/mL (186.97 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.66 mL | 183.3 mL | 366.61 mL |
| 0.5 mM | 7.33 mL | 36.66 mL | 73.32 mL |
| 1 mM | 3.67 mL | 18.33 mL | 36.66 mL |
| 5 mM | 0.73 mL | 3.67 mL | 7.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
