Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (R)-GNE-140 is a potent lactate dehydrogenase A (LDHA) inhibitor, with IC50s of 3 nM and 5 nM for LDHA and LDHB, respectively; (R)-GNE-140 is 18-fold more potent than S enantiomer. |
|---|
| Catalog Num | A21863 |
|---|---|
| Formula | C25H23ClN2O3S2 |
| Molecular Weight | 499.04 |
| CAS Number | 2003234-63-5 |
| SMILES | O=C1N[C@@](C2=CSC=C2)(C3=CC=C(N4CCOCC4)C=C3)CC(O)=C1SC5=CC=CC=C5Cl |
| Synonyms | GNE140, GNE 140 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (176.33 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.04 mL | 100.19 mL | 200.38 mL |
| 0.5 mM | 4.01 mL | 20.04 mL | 40.08 mL |
| 1 mM | 2 mL | 10.02 mL | 20.04 mL |
| 5 mM | 0.4 mL | 2 mL | 4.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
