Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rabeprazole is an inhibitor of H(+)-K(+)-exchanging atpase in gastric parietal cells. |
|---|
| Catalog Num | A17437 |
|---|---|
| Formula | C18H21N3O3S |
| Molecular Weight | 359.44 |
| CAS Number | 117976-89-3 |
| SMILES | O=S(C1=NC2=CC=CC=C2N1)CC3=NC=CC(OCCCOC)=C3C |
| Synonyms | Rabeprazole |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (191.96 mM) | |
| Water | 69 mg/mL (191.96 mM) | ||
| Ethanol | 69 mg/mL (191.96 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.82 mL | 139.11 mL | 278.21 mL |
| 0.5 mM | 5.56 mL | 27.82 mL | 55.64 mL |
| 1 mM | 2.78 mL | 13.91 mL | 27.82 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
