Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Raphin1 is an orally bioavailable, selective inhibitor of the regulatory phosphatase PPP1R15B (R15B). |
|---|
| Catalog Num | A19060 |
|---|---|
| Formula | C8H8Cl2N4 |
| Molecular Weight | 231.08 |
| CAS Number | 2022961-17-5 |
| SMILES | N=C(N/N=C/C1=CC=CC(Cl)=C1Cl)N |
| Synonyms | Raphin 1, Raphin-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (190.41 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 2 mg/mL (8.65 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.28 mL | 216.38 mL | 432.75 mL |
| 0.5 mM | 8.66 mL | 43.28 mL | 86.55 mL |
| 1 mM | 4.33 mL | 21.64 mL | 43.28 mL |
| 5 mM | 0.87 mL | 4.33 mL | 8.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
