Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Roblitinib (FGF-401; Compound Example 83) is a highly selective and potent FGFR4 inhibitor with an IC50 of 1.9 nM. Roblitinib has antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19431 |
|---|---|
| Formula | C25H30N8O4 |
| Molecular Weight | 506.56 |
| CAS Number | 1708971-55-4 |
| SMILES | CN1CC(N(CC2=CC(CCCN3C(NC4=CC(NCCOC)=C(C#N)C=N4)=O)=C3N=C2C=O)CC1)=O |
| Synonyms | FGF-401, FGF401, FGF 401 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (9.87 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (3.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.74 mL | 98.7 mL | 197.41 mL |
| 0.5 mM | 3.95 mL | 19.74 mL | 39.48 mL |
| 1 mM | 1.97 mL | 9.87 mL | 19.74 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
