Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | S-Gboxin, a functional analogue of Gboxin, inhibits growth of mouse and human glioblastoma (GBM) with an IC50 of 470 nM. Antitumour activity. |
|---|
| Catalog Num | A13002 |
|---|---|
| Formula | C27H32F3IN2O2 |
| Molecular Weight | 600.45 |
| CAS Number | 2101317-21-7 |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(CN2C(C=CC=C3)=C3[N+](C)=C2C4=CC(C(F)(F)F)=CC=C4)=O.[I-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (153.22 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 92 mg/mL (153.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.65 mL | 83.27 mL | 166.54 mL |
| 0.5 mM | 3.33 mL | 16.65 mL | 33.31 mL |
| 1 mM | 1.67 mL | 8.33 mL | 16.65 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
