Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TH5487 is a potent 8-oxoguanine DNA glycosylase 1 (OGG1) inhibitor with an IC50 of 342 nM. TH5487 stops OGG1 from recognizing its DNA substrate, inhibits DNA repair and modifies OGG1 chromatin dynamics, which results in the inhibition of proinflammatory pathway genes. |
|---|
| Catalog Num | A18537 |
|---|---|
| Formula | C19H18BrIN4O2 |
| Molecular Weight | 541.18 |
| CAS Number | 2304947-71-3 |
| SMILES | O=C(N1CCC(N(C2=CC=CC(Br)=C2N3)C3=O)CC1)NC4=CC=C(I)C=C4 |
| Synonyms | TH 5487; TH5487; TH-5487 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (16.62 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.48 mL | 92.39 mL | 184.78 mL |
| 0.5 mM | 3.7 mL | 18.48 mL | 36.96 mL |
| 1 mM | 1.85 mL | 9.24 mL | 18.48 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
