Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Trilaciclib is a potential first-in-class short-acting CDK4/6 inhibitor in development to preserve hematopoietic stem cells and enhance immune system function during chemotherapy. |
|---|
| Catalog Num | A17084 |
|---|---|
| Formula | C24H30N8O |
| Molecular Weight | 446.56 |
| CAS Number | 1374743-00-6 |
| SMILES | O=C1NCC2(N3C1=CC4=CN=C(NC5=NC=C(N6CCN(C)CC6)C=C5)N=C43)CCCCC2 |
| Synonyms | G1T28, G1T-28, G1T 28 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.39 mL | 111.97 mL | 223.93 mL |
| 0.5 mM | 4.48 mL | 22.39 mL | 44.79 mL |
| 1 mM | 2.24 mL | 11.2 mL | 22.39 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
