Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Vilazodone Hydrochloride (EMD 68843 Hydrochloride) is a serotonin transporter (SER) inhibitor and 5-HT1A receptor partial agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11604 |
|---|---|
| Formula | C26H28ClN5O2 |
| Molecular Weight | 477.99 |
| CAS Number | 163521-08-2 |
| SMILES | NC(C1=CC2=C(C=CC(N3CCN(CCCCC4=CNC5=CC=C(C=C54)C#N)CC3)=C2)O1)=O.[H]Cl |
| Synonyms | EMD 68843, EMD-68843, EMD68843 (Hydrochloride); SB659746A,SB 659746A, SB-659746A (Hydrochloride) |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (175.74 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.92 mL | 104.6 mL | 209.21 mL |
| 0.5 mM | 4.18 mL | 20.92 mL | 41.84 mL |
| 1 mM | 2.09 mL | 10.46 mL | 20.92 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
