Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | YM-58483 is the first selective and potent inhibitor of CRAC channels and subsequent Ca2+ signals. |
|---|
| Catalog Num | A16346 |
|---|---|
| Formula | C15H9F6N5OS |
| Molecular Weight | 421.32 |
| CAS Number | 223499-30-7 |
| SMILES | FC(F)(C1=CC(C(F)(F)F)=NN1C(C=C2)=CC=C2NC(C3=C(C)N=NS3)=O)F |
| Synonyms | YM58483, YM 58483, BPT2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 76 mg/mL (180.38 mM) | |
| Water | Insoluble | ||
| Ethanol | 76 mg/mL (180.38 mM) | ||
| In vivo | 1% CMC Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.73 mL | 118.67 mL | 237.35 mL |
| 0.5 mM | 4.75 mL | 23.73 mL | 47.47 mL |
| 1 mM | 2.37 mL | 11.87 mL | 23.73 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
