Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 2',3'-cGAMP (2'-3'-cyclic GMP-AMP) is a endogenous cGAMP in mammalian cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12277 |
|---|---|
| Formula | C20H24N10O13P2 |
| Molecular Weight | 674.41 |
| CAS Number | 1441190-66-4 |
| SMILES | OC1([H])[C@](OP(O)(OC[C@](O[C@@H](N2C3=NC=NC(N)=C3N=C2)[C@@H]4O)([H])[C@@]4([H])O5)=O)([H])[C@H](N6C(NC(N)=NC7=O)=C7N=C6)O[C@]1([H])COP5(O)=O |
| Synonyms | 2'-3'-cyclic GMP-AMP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (16.7 mM) | |
| Water | 49 mg/mL (68.21 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.83 mL | 74.14 mL | 148.28 mL |
| 0.5 mM | 2.97 mL | 14.83 mL | 29.66 mL |
| 1 mM | 1.48 mL | 7.41 mL | 14.83 mL |
| 5 mM | 0.3 mL | 1.48 mL | 2.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
