Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (3-Carboxypropyl)trimethylammonium chloride is angiopathic substance produced as an intermediary metabolite by gut microbiota that feed on carnitine in dietary red meat. |
|---|
| Catalog Num | A21725 |
|---|---|
| Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 |
| CAS Number | 6249-56-5 |
| SMILES | C[N+](C)(C)CCCC(O)=O.[Cl-] |
| Synonyms | γ-Butyrobetaine hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 33 mg/mL (181.66 mM) | |
| Water | 33 mg/mL (181.66 mM) | ||
| Ethanol | 33 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 55.05 mL | 275.24 mL | 550.48 mL |
| 0.5 mM | 11.01 mL | 55.05 mL | 110.1 mL |
| 1 mM | 5.5 mL | 27.52 mL | 55.05 mL |
| 5 mM | 1.1 mL | 5.5 mL | 11.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
