Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4-Aminoantipyrine is a metabolite of aminopyrine with analgesic, anti-inflammatory, and antipyretic properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16007 |
|---|---|
| Formula | C11H13N3O |
| Molecular Weight | 203.24 |
| CAS Number | CAS: 83-07-8 |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
| Synonyms | Ampyrone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (172.21 mM) | |
| Water | 35 mg/mL (172.21 mM) | ||
| Ethanol | 35 mg/mL (172.21 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.2 mL | 246.01 mL | 492.03 mL |
| 0.5 mM | 9.84 mL | 49.2 mL | 98.41 mL |
| 1 mM | 4.92 mL | 24.6 mL | 49.2 mL |
| 5 mM | 0.98 mL | 4.92 mL | 9.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
