Signaling Pathway
AMPK activator
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 7-Methoxyisoflavone is an isoflavone derivative and also an activator of adenosine monophosphate-activated protein kinase (AMPK). |
|---|
| Catalog Num | A17097 |
|---|---|
| Formula | C16H12O3 |
| Molecular Weight | 252.26 |
| CAS Number | 1621-56-3 |
| SMILES | O=C1C(C2=CC=CC=C2)=COC3=CC(OC)=CC=C13 |
| Synonyms | 7Methoxyisoflavone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 27 mg/mL (107.03 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.64 mL | 198.21 mL | 396.42 mL |
| 0.5 mM | 7.93 mL | 39.64 mL | 79.28 mL |
| 1 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 5 mM | 0.79 mL | 3.96 mL | 7.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
