Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Metoprolol is a β1 selective aryloxypropanolamine andrenergic antagonist. Used in the treatment of a variety of cardiovascular disorder. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17639 |
|---|---|
| Formula | C15H25NO3 |
| Molecular Weight | 267.36 |
| CAS Number | 51384-51-1 |
| SMILES | OC(COC1=CC=C(CCOC)C=C1)CNC(C)C |
| Synonyms | Metoprolol; Loresor; Preblok; Metohexal; Selo-Zok; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (179.53 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.4 mL | 187.01 mL | 374.03 mL |
| 0.5 mM | 7.48 mL | 37.4 mL | 74.81 mL |
| 1 mM | 3.74 mL | 18.7 mL | 37.4 mL |
| 5 mM | 0.75 mL | 3.74 mL | 7.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
