Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MIK665 (S-64315) is a special Mcl-1 inhibitor extracted from patent WO2016207225A1, compound Preparation 13, has an IC50 of 1.81 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18362 |
|---|---|
| Formula | C47H44ClFN6O6S |
| Molecular Weight | 875.41 |
| CAS Number | 1799631-75-6 |
| SMILES | OC([C@@H](CC(C=CC=C1)=C1OCC2=CC=NC(C3=CC=CC=C3OC)=N2)OC4=C5[C@]([C@]6=C(C)C(Cl)=C(OCCN7CCN(C)CC7)C=C6)=C(C8=CC=C(F)C=C8)SC5=NC=N4)=O |
| Synonyms | MIK665; MIK-665; MIK 665; S 64315; S-64315; S64315 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (105.09 mM) | |
| Water | Insoluble | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.42 mL | 57.12 mL | 114.23 mL |
| 0.5 mM | 2.28 mL | 11.42 mL | 22.85 mL |
| 1 mM | 1.14 mL | 5.71 mL | 11.42 mL |
| 5 mM | 0.23 mL | 1.14 mL | 2.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
