Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML327 is a blocker of MYC. ML327 mediated transcriptional de-repression of E-cadherin and inhibition of epithelial-to-mesenchymal transition. |
|---|
| Catalog Num | A17009 |
|---|---|
| Formula | C19H18N4O4 |
| Molecular Weight | 366.38 |
| CAS Number | 1883510-31-3 |
| SMILES | C1C=CNC(=O)C=1C(=O)NCCCNC(=O)C1=NOC(C2=CC=CC=C2)=C1 |
| Synonyms | ML-327, ML 327 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (122.82 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.29 mL | 136.47 mL | 272.94 mL |
| 0.5 mM | 5.46 mL | 27.29 mL | 54.59 mL |
| 1 mM | 2.73 mL | 13.65 mL | 27.29 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
