Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Osalmid is a ribonucleotide reductase small subunit M2 (RRM2) targeting compound; suppresses ribonucleotide reductase activity with an IC50 of 8.23 μM. |
|---|
| Catalog Num | A17265 |
|---|---|
| Formula | C13H11NO3 |
| Molecular Weight | 229.23 |
| CAS Number | 526-18-1 |
| SMILES | O=C(NC1=CC=C(O)C=C1)C2=CC=CC=C2O |
| Synonyms | Osalmid; Auxobil; Oksafenamid; NSC 93960; NSC-93960; NSC93960; Salmidochol; PHPS; Saryuurin; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (187.58 mM) | |
| Water | Insoluble | ||
| Ethanol | 43 mg/mL (187.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.62 mL | 218.12 mL | 436.24 mL |
| 0.5 mM | 8.72 mL | 43.62 mL | 87.25 mL |
| 1 mM | 4.36 mL | 21.81 mL | 43.62 mL |
| 5 mM | 0.87 mL | 4.36 mL | 8.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
