Signaling Pathway
sigma1 receptor
agonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Anavex2-73 is a muscarinic/moderate sigma1 receptor agonist that alleviated the scopolamine- and dizocilpine-induced learning impairments. CAS: 195615-83-9 (Free base) 195615-84-0 (HCl) |
|---|
| Catalog Num | A17145 |
|---|---|
| Formula | C19H24ClNO |
| Molecular Weight | 317.85 |
| CAS Number | 195615-84-0 |
| SMILES | CN(C)CC1C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC1.[H]Cl |
| Synonyms | Anavex-273, Anavex273, Anavex 273 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (179.33 mM) | |
| Water | 57 mg/mL (179.33 mM) | ||
| Ethanol | 3 mg/mL (9.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.46 mL | 157.31 mL | 314.61 mL |
| 0.5 mM | 6.29 mL | 31.46 mL | 62.92 mL |
| 1 mM | 3.15 mL | 15.73 mL | 31.46 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
