Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Anle138b is an oligomeric aggregation inhibitor. Anle138b is an oligomer modulator for neurodegenerative diseases such Parkinson's disease. |
|---|
| Catalog Num | A20001 |
|---|---|
| Formula | C16H11BrN2O2 |
| Molecular Weight | 343.17 |
| CAS Number | 882697-00-9 |
| SMILES | BrC1=CC(C2=CC(C3=CC=C(OCO4)C4=C3)=NN2)=CC=C1 |
| Synonyms | Anle 138b, Anle-138b |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (174.83 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.14 mL | 145.7 mL | 291.4 mL |
| 0.5 mM | 5.83 mL | 29.14 mL | 58.28 mL |
| 1 mM | 2.91 mL | 14.57 mL | 29.14 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
