Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Baloxavir marboxil is an antiviral agent. CAS: 1985605-59-1 (Baloxavir) 1985606-14-1 (Baloxavir marboxil) |
|---|
| Catalog Num | A17088 |
|---|---|
| Formula | C27H23F2N3O7S |
| Molecular Weight | 571.55 |
| CAS Number | 1985606-14-1 |
| SMILES | O=C(OCOC(C(C=C1)=O)=C(N1N([C@@H]2C3=CC=CC=C3SCC4=C(F)C(F)=CC=C24)[C@@]5([H])N6CCOC5)C6=O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (167.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (12.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.5 mL | 87.48 mL | 174.96 mL |
| 0.5 mM | 3.5 mL | 17.5 mL | 34.99 mL |
| 1 mM | 1.75 mL | 8.75 mL | 17.5 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
