Signaling Pathway
Topoisomerase I inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Belotecan, also known as CKD-602, is the semi-synthetic camptothecin analogue belotecan with potential antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18035 |
|---|---|
| Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 |
| CAS Number | 213819-48-8 |
| SMILES | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=C(CCNC(C)C)C5=CC=CC=C5N=C4C3=C2)=O.[H]Cl |
| Synonyms | Belotecan Hydrochloride, Camtobell, CKD602, CKD-602, CKD 602, Belotecan |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (100 mM) | |
| Water | 4 mg/mL (8.51 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.28 mL | 106.39 mL | 212.78 mL |
| 0.5 mM | 4.26 mL | 21.28 mL | 42.56 mL |
| 1 mM | 2.13 mL | 10.64 mL | 21.28 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
