Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bictegravir, also known as GS-9883, is a potent, unboosted, once-Daily HIV-1 Integrase Strand Transfer Inhibitor (INSTI) (IC50 - 1.6 nM) with improved pharmacokinetics and in vitro resistance profile. |
|---|
| Catalog Num | A17011 |
|---|---|
| Formula | C21H18F3N3O5 |
| Molecular Weight | 449.38 |
| CAS Number | 1611493-60-7 |
| SMILES | O=C(C1=CN(C2=C(O)C1=O)C[C@@]3([H])O[C@](C4)([H])CC[C@]4([H])N3C2=O)NCC5=C(F)C=C(F)C=C5F |
| Synonyms | GS-9883, GS 9883, GS9883 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (191.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.25 mL | 111.26 mL | 222.53 mL |
| 0.5 mM | 4.45 mL | 22.25 mL | 44.51 mL |
| 1 mM | 2.23 mL | 11.13 mL | 22.25 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
