Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BIBF0775 is an inhibitor of the transforming growth factor β receptor I (TGFβRI). |
|---|
| Catalog Num | A17230 |
|---|---|
| Formula | C31H34N4O2 |
| Molecular Weight | 494.639 |
| CAS Number | 334951-90-5 |
| SMILES | O=C(C1=CC(NC/2=O)=C(C=C1)C2=C(C3=CC=CC=C3)\NC4=CC=C(CN5CCCCC5)C=C4)N(CC)C |
| Synonyms | BIBF-0775; BIBF 0775; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 13 mg/mL (26.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.22 mL | 101.08 mL | 202.17 mL |
| 0.5 mM | 4.04 mL | 20.22 mL | 40.43 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.22 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
