Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BIO is a cell-permeable bis-indolo (indirubin) compound that acts as a highly potent, selective, reversible, and ATP-competitive inhibitor of GSK3α/β with IC50 value of 5 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17129 |
|---|---|
| Formula | C16H10BrN3O2 |
| Molecular Weight | 356.18 |
| CAS Number | 667463-62-9 |
| SMILES | O=C(/C1=C2NC3=C(C\2=N/O)C=CC=C3)NC4=C1C=CC(Br)=C4 |
| Synonyms | GSK3 Inhibitor IX, MLS 2052, MLS-2052, MLS2052 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 70 mg/mL (196.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (16.84 mM) | ||
| In vivo | 5% DMSO+40% PEG 300+5% Tween 80+50%ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.08 mL | 140.38 mL | 280.76 mL |
| 0.5 mM | 5.62 mL | 28.08 mL | 56.15 mL |
| 1 mM | 2.81 mL | 14.04 mL | 28.08 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
