Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CZC-8004 is a pan-kinase inhibitor and binds a range of tyrosine kinases, including ABL kinase. |
|---|
| Catalog Num | A19444 |
|---|---|
| Formula | C17H16FN5 |
| Molecular Weight | 309.34 |
| CAS Number | 916603-07-1 |
| SMILES | FC1=CN=C(NC2=CC=C(CN)C=C2)N=C1NC3=CC=CC=C3 |
| Synonyms | CZC 8004, CZC8004, CZC-00008004, CZC00008004, CZC 00008004 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (187.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.33 mL | 161.63 mL | 323.27 mL |
| 0.5 mM | 6.47 mL | 32.33 mL | 64.65 mL |
| 1 mM | 3.23 mL | 16.16 mL | 32.33 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
