Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Canagliflozin hemihydrate is the hemihydrate form of canagliflozin, which is a SGLT2 inhibitor with IC50 of 2.2 nM for hSGLT2 in a cell-free assay, exhibits 413-fold selectivity over hSGLT1. |
|---|
| Catalog Num | A16817 |
|---|---|
| Formula | C48H52F2O11S2 |
| Molecular Weight | 907.05 |
| CAS Number | 928672-86-0 |
| SMILES | O[C@H]1C(O[C@@H]([C@H]([C@@H]1O)O)CO)C2=CC=C(C(CC3=CC=C(S3)C4=CC=C(C=C4)F)=C2)C.[H]O[H].O[C@H]5C(O[C@@H]([C@H]([C@@H]5O)O)CO)C6=CC=C(C(CC7=CC=C(S7)C8=CC=C(C=C8)F)=C6)C |
| Synonyms | JNJ 28431754; JNJ-28431754; JNJ28431754; TA 7284; TA-7284; TA7284; JNJ-24831754-ZAE; JNJ-28431754-AAA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (103.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 94 mg/mL (103.63 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.02 mL | 55.12 mL | 110.25 mL |
| 0.5 mM | 2.2 mL | 11.02 mL | 22.05 mL |
| 1 mM | 1.1 mL | 5.51 mL | 11.02 mL |
| 5 mM | 0.22 mL | 1.1 mL | 2.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
