Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefuroxime Sodium is a cephalosporin effective against gram-positive and gram-negative bacteria with resistance to beta-lactamase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16436 |
|---|---|
| Formula | C16H16N4O8S.Na |
| Molecular Weight | 446.37 |
| CAS Number | 56238-63-2 |
| SMILES | CON=C(C1=CC=CO1)C(=O)NC2C3N(C2=O)C(=C(CS3)COC(=O)N)C(=O)[O-].[Na+] |
| Synonyms | Cefuroxime sodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (172.5 mM) | |
| Water | 77 mg/mL (172.5 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.4 mL | 112.01 mL | 224.03 mL |
| 0.5 mM | 4.48 mL | 22.4 mL | 44.81 mL |
| 1 mM | 2.24 mL | 11.2 mL | 22.4 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
