Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chloroquine phosphate is a 4-aminoquinoline anti-malarial and anti-rheumatoid agent, also acting as an ATM activator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16445 |
|---|---|
| Formula | C18H26ClN3.2H3O4P |
| Molecular Weight | 515.86 |
| CAS Number | 50-63-5 |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O.OP(=O)(O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 96 mg/mL (186.1 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.39 mL | 96.93 mL | 193.85 mL |
| 0.5 mM | 3.88 mL | 19.39 mL | 38.77 mL |
| 1 mM | 1.94 mL | 9.69 mL | 19.39 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
