Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CM-272 is a reversible dual small molecule inhibitor against G9a and DNMTs in hematological malignancies. CAS: 1846570-31-7 (free base) 1846570-32-8 (TFA) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17173 |
|---|---|
| Formula | C28H38N4O3 |
| Molecular Weight | 478.63 |
| CAS Number | 1846570-31-7 |
| SMILES | CN1CCC(NC2=CC(C3=CC=C(C)O3)=NC4=CC(OCCCN5CCCC5)=C(OC)C=C24)CC1 |
| Synonyms | CM272, CM 272 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (198.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 95 mg/mL (198.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.89 mL | 104.46 mL | 208.93 mL |
| 0.5 mM | 4.18 mL | 20.89 mL | 41.79 mL |
| 1 mM | 2.09 mL | 10.45 mL | 20.89 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
