Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diatrizoate Sodium is an X-ray contrast agent. Diatrizoate sodium blocks X-rays which lets body structures with iodine to be delineated in comparison to the structures that do not have iodine. |
|---|
| Catalog Num | A17075 |
|---|---|
| Formula | C11H8I3N2NaO4 |
| Molecular Weight | 635.89 |
| CAS Number | 737-31-5 |
| SMILES | CC(Nc1c(I)c(C([O-])=O)c(I)c(NC(C)=O)c1I)=O.[Na+] |
| Synonyms | Sodium diatrizoate, Hypaque, MD-50, MD 50, MD50, Triombrin, Urovist Sodium, |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (133.66 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.73 mL | 78.63 mL | 157.26 mL |
| 0.5 mM | 3.15 mL | 15.73 mL | 31.45 mL |
| 1 mM | 1.57 mL | 7.86 mL | 15.73 mL |
| 5 mM | 0.31 mL | 1.57 mL | 3.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
