Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FICZ is a potent aryl hydrocarbon receptor (AhR) agonist with a Kd of 70 pM. |
|---|
| Catalog Num | A21452 |
|---|---|
| Formula | C19H12N2O |
| Molecular Weight | 284.31 |
| CAS Number | 172922-91-7 |
| SMILES | O=CC1=C2C(NC3=C2C=CC=C3)=CC4=C1NC5=C4C=CC=C5 |
| Synonyms | 6-Formylindolo[3,2-b]carbazole |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (189.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.17 mL | 175.86 mL | 351.73 mL |
| 0.5 mM | 7.03 mL | 35.17 mL | 70.35 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.17 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
