Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | G-418 (disulfate) is an aminoglycoside antibiotic similar in structure to gentamicin B1, which blocks polypeptide synthesis by inhibiting the elongation step in both prokaryotic and eukaryotic cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21002 |
|---|---|
| Formula | C20H44N4O18S2 |
| Molecular Weight | 692.71 |
| CAS Number | 108321-42-2 |
| SMILES | O=S(O)(O)=O.O[C@@H]([C@@H]1O[C@@]([C@@H]([C@@H](O)[C@@H]2O)N)([H])O[C@]2([H])[C@H](O)C)[C@H]([C@@H](C[C@@H]1N)N)O[C@](OC[C@](C)(O)[C@@H]3NC)([H])[C@@H]3O.O=S(O)(O)=O |
| Synonyms | Geneticin sulfate; Antibiotic G-418 sulfate, G418, G 418 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Insoluble | |
| Water | Warmed: 92 mg/mL (132.81 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.44 mL | 72.18 mL | 144.36 mL |
| 0.5 mM | 2.89 mL | 14.44 mL | 28.87 mL |
| 1 mM | 1.44 mL | 7.22 mL | 14.44 mL |
| 5 mM | 0.29 mL | 1.44 mL | 2.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
