Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK8612 is a highly selective and potent Tank-binding Kinase-1 (TBK1) inhibitor, with a pIC50 of 6.8 for recombinant TBK1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19438 |
|---|---|
| Formula | C17H17BrF3N7O2S |
| Molecular Weight | 520.33 |
| CAS Number | 2361659-62-1 |
| SMILES | NS(C1=CC=C(CNC2=C(Br)C=NC(NC3=CN(CC(F)(F)F)N=C3C)=N2)C=C1)(=O)=O |
| Synonyms | GSK-8612; GSK 8612 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (176.81 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (11.53 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.22 mL | 96.09 mL | 192.19 mL |
| 0.5 mM | 3.84 mL | 19.22 mL | 38.44 mL |
| 1 mM | 1.92 mL | 9.61 mL | 19.22 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
