Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Iopanoic acid is an inhibitor of 5'-Deiodinase and also an iodinated contrast medium. |
|---|
| Catalog Num | A17658 |
|---|---|
| Formula | C11H12I3NO2 |
| Molecular Weight | 570.94 |
| CAS Number | 96-83-3 |
| SMILES | O=C(O)C(CC)CC1=C(I)C=C(I)C(N)=C1I |
| Synonyms | Iopanoic Acid; Telepaque; BRN 2220381; BRN-2220381; BRN2220381 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (157.64 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.51 mL | 87.57 mL | 175.15 mL |
| 0.5 mM | 3.5 mL | 17.51 mL | 35.03 mL |
| 1 mM | 1.75 mL | 8.76 mL | 17.51 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
