Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pyrotinib dimaleate (SHR-1258 dimaleate) is a potent and selective EGFR/HER2 dual inhibitor with IC50 s of 13 and 38 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21756 |
|---|---|
| Formula | C40H39ClN6O11 |
| Molecular Weight | 815.22 |
| CAS Number | 1397922-61-0 |
| SMILES | O=C(NC1=C(OCC)C=C2N=CC(C#N)=C(NC3=CC=C(OCC4=NC=CC=C4)C(Cl)=C3)C2=C1)/C=C/[C@@H]5N(C)CCC5.O=C(O)/C=C\C(O)=O.O=C(O)/C=C\C(O)=O |
| Synonyms | SHR-1258 dimaleate, SHR1258, SHR 1258 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.27 mL | 61.33 mL | 122.67 mL |
| 0.5 mM | 2.45 mL | 12.27 mL | 24.53 mL |
| 1 mM | 1.23 mL | 6.13 mL | 12.27 mL |
| 5 mM | 0.25 mL | 1.23 mL | 2.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
