Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rafoxanide is a salicylanilide used as an anthelmintic. It is used to treat fluke, hookworm and other infestations. |
|---|
| Catalog Num | A17524 |
|---|---|
| Formula | C19H11Cl2I2NO3 |
| Molecular Weight | 626.01 |
| CAS Number | 22662-39-1 |
| SMILES | OC1=C(I)C=C(I)C=C1C(NC2=CC=C(OC3=CC=C(Cl)C=C3)C(Cl)=C2)=O |
| Synonyms | Rafoxanide; BRN 2228187; Disalan; Duofas; EINECS 245-148-9 ; Flukanide ; NSC 355278; Rafoxanida. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (146.96 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.97 mL | 79.87 mL | 159.74 mL |
| 0.5 mM | 3.19 mL | 15.97 mL | 31.95 mL |
| 1 mM | 1.6 mL | 7.99 mL | 15.97 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
