Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SCH58261 is a potent and selective A2a adenosine receptor antagonist with Ki of 2.3 nM and 2 nM for rat A2a and bovine A2a, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15886 |
|---|---|
| Formula | C18H15N7O |
| Molecular Weight | 345.36 |
| CAS Number | 160098-96-4 |
| SMILES | NC1=NC(N(CCC2=CC=CC=C2)N=C3)=C3C4=NC(C5=CC=CO5)=NN14 |
| Synonyms | SCH-58261, SCH 58261 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 61 mg/mL (176.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO40% PEG 300+4% Tween 80++ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.96 mL | 144.78 mL | 289.55 mL |
| 0.5 mM | 5.79 mL | 28.96 mL | 57.91 mL |
| 1 mM | 2.9 mL | 14.48 mL | 28.96 mL |
| 5 mM | 0.58 mL | 2.9 mL | 5.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
