Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tubeimoside I is a triterpenoid saponin isolated from tubers of bolbostemma paniculatum. Used as anti-tumor agent, induces cell cycle arrest and apoptosis. |
|---|
| Catalog Num | A14511 |
|---|---|
| Formula | C63H98O29 |
| Molecular Weight | 1319.43 |
| CAS Number | 102040-03-9 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2OC(=O)[C@@]34CC[C@@]5(C(=CC[C@H]6[C@]5(CC[C@@H]7[C@@]6(C[C@@H]([C@H]8[C@]7(COC(=O)CC(CC(=O)O[C@@H]9[C@H]([C@H](CO[C@H]9O[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O8)CO)O)O)O)O)(C)O)C)O)C)C)[C@@H]3CC(CC4)(C)C)C)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O |
| Synonyms | Tubeimoside A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (71.24 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.58 mL | 37.9 mL | 75.79 mL |
| 0.5 mM | 1.52 mL | 7.58 mL | 15.16 mL |
| 1 mM | 0.76 mL | 3.79 mL | 7.58 mL |
| 5 mM | 0.15 mL | 0.76 mL | 1.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
