Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Topotecan is an antineoplastic agent used to treat ovarian cancer that works by inhibiting DNA topoisomerases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16815 |
|---|---|
| Formula | C23H23N3O5 |
| Molecular Weight | 421.45 |
| CAS Number | 123948-87-8 |
| SMILES | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=C(CN(C)C)C(O)=CC=C5N=C4C3=C2)=O |
| Synonyms | SKF104864, SKF 104864, SKF-104864, NSC 609669, NSC609669, NSC-609669 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (180.33 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.73 mL | 118.64 mL | 237.28 mL |
| 0.5 mM | 4.75 mL | 23.73 mL | 47.46 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.73 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
