Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UM-164 (DAS-DFGO-II) is a highly potent inhibitor of c-Src with a Kd of 2.7 nM. UM-164 also potently inhibits p38α and p38β. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19895 |
|---|---|
| Formula | C30H31F3N8O3S |
| Molecular Weight | 640.68 |
| CAS Number | 903564-48-7 |
| SMILES | O=C(C1=CN=C(NC2=NC(C)=NC(N3CCN(CCO)CC3)=C2)S1)NC4=CC(NC(C5=CC=CC(C(F)(F)F)=C5)=O)=CC=C4C |
| Synonyms | DAS-DFGO-II, UM164, UM 164 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (132.67 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.61 mL | 78.04 mL | 156.08 mL |
| 0.5 mM | 3.12 mL | 15.61 mL | 31.22 mL |
| 1 mM | 1.56 mL | 7.8 mL | 15.61 mL |
| 5 mM | 0.31 mL | 1.56 mL | 3.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
