Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Zafirlukast is a potent orally active leukotriene D4 (LTD4) receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11004 |
|---|---|
| Formula | C31H33N3O6S |
| Molecular Weight | 575.68 |
| CAS Number | 107753-78-6 |
| SMILES | O=C(OC1CCCC1)NC2=CC3=C(N(C)C=C3CC4=CC=C(C(NS(=O)(C5=CC=CC=C5C)=O)=O)C=C4OC)C=C2 |
| Synonyms | ICI 204219, ICI-204219, ICI204219 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (171.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+5% Tween 80+ddH2O | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.37 mL | 86.85 mL | 173.71 mL |
| 0.5 mM | 3.47 mL | 17.37 mL | 34.74 mL |
| 1 mM | 1.74 mL | 8.69 mL | 17.37 mL |
| 5 mM | 0.35 mL | 1.74 mL | 3.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
