Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MD2-IN-1 is an inhibitor of Myeloid differentiation protein 2 (MD2) with a KD of 189 ?μM for the recombinant human MD2 (rhMD2). |
|---|
| Catalog Num | A13147 |
|---|---|
| Formula | C20H22O6 |
| Molecular Weight | 358.39 |
| CAS Number | 111797-22-9 |
| SMILES | O=C(C1=CC=C(OC)C(OC)=C1)/C=C/C2=CC(OC)=C(OC)C(OC)=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (181.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.9 mL | 139.51 mL | 279.03 mL |
| 0.5 mM | 5.58 mL | 27.9 mL | 55.81 mL |
| 1 mM | 2.79 mL | 13.95 mL | 27.9 mL |
| 5 mM | 0.56 mL | 2.79 mL | 5.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
