Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MPO-IN-28 (Compound 28) is a myeloperoxidase (MPO) inhibitor with an IC50 of 44 nM. |
|---|
| Catalog Num | A18941 |
|---|---|
| Formula | C11H13N5O |
| Molecular Weight | 231.25 |
| CAS Number | 37836-90-1 |
| SMILES | NC(NC1=NC(C)=C2C=CC(OC)=CC2=N1)=N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (185.94 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.24 mL | 216.22 mL | 432.43 mL |
| 0.5 mM | 8.65 mL | 43.24 mL | 86.49 mL |
| 1 mM | 4.32 mL | 21.62 mL | 43.24 mL |
| 5 mM | 0.86 mL | 4.32 mL | 8.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
