Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NVP-2 is a potent and selective ATP-competitive CDK9 inhibitor with IC50 value of 0.5 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17022 |
|---|---|
| Formula | C27H37ClN6O2 |
| Molecular Weight | 513.08 |
| CAS Number | 1263373-43-8 |
| SMILES | COC[C@H](N[C@H]1CC[C@H](NC2=CC(C3=NC(NCC4(C#N)CCOCC4)=CC=C3)=C(C=N2)Cl)CC1)C |
| Synonyms | NVP 2, NVP2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (185.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 95 mg/mL (185.16 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.49 mL | 97.45 mL | 194.9 mL |
| 0.5 mM | 3.9 mL | 19.49 mL | 38.98 mL |
| 1 mM | 1.95 mL | 9.75 mL | 19.49 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
