Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nedisertib, also known as M-3814, MSC2490484A, is an orally available inhibitor of DNA-dependent protein kinase (DNA-PK), with potential antineoplastic and chemo/radiosensitizing activities. |
|---|
| Catalog Num | A17055 |
|---|---|
| Formula | C24H21ClFN5O3 |
| Molecular Weight | 481.91 |
| CAS Number | 1637542-33-6 |
| SMILES | COC1=CC=C([C@@H](O)C2=CC(C3=C(C=CC(N4CCOCC4)=C5)C5=NC=N3)=C(F)C=C2Cl)N=N1 |
| Synonyms | MSC2490484A, MSC-2490484A; MSC 2490484A, M3814, M-3814, M 3814 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (178.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.15 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.75 mL | 103.75 mL | 207.51 mL |
| 0.5 mM | 4.15 mL | 20.75 mL | 41.5 mL |
| 1 mM | 2.08 mL | 10.38 mL | 20.75 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
