Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nintedanib is a potent inhibitor of multiple receptor tyrosine kinases (RTKs) and non-receptor tyrosine kinases (nRTKs). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16197 |
|---|---|
| Formula | C33H39N5O7S |
| Molecular Weight | 649.76 |
| CAS Number | 656247-18-6 |
| SMILES | O=C(C1=CC(NC/2=O)=C(C=C1)C2=C(NC3=CC=C(N(C)C(CN4CCN(C)CC4)=O)C=C3)/C5=CC=CC=C5)OC.CCS(=O)(O)=O |
| Synonyms | BIBF-1120 esylate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (136.97 mM) | |
| Water | 89 mg/mL (136.97 mM) | ||
| Ethanol | 4 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.39 mL | 76.95 mL | 153.9 mL |
| 0.5 mM | 3.08 mL | 15.39 mL | 30.78 mL |
| 1 mM | 1.54 mL | 7.7 mL | 15.39 mL |
| 5 mM | 0.31 mL | 1.54 mL | 3.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
